C26H34O — CID 174178337
(8S,9S,13S,14S,17R)-3-cyclopentyloxy-17-ethynyl-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 174178337) has the molecular formula C26H34O and a molecular weight of 362.56 g/mol. Its IUPAC name is (8S,9S,13S,14S,17R)-3-cyclopentyloxy-17-ethynyl-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S,17R)-3-cyclopentyloxy-17-ethynyl-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 174178337 |
| Molecular Formula | C26H34O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (8S,9S,13S,14S,17R)-3-cyclopentyloxy-17-ethynyl-13,17-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | C#C[C@@]1(C)CC[C@H]2[C@@H]3CCc4cc(OC5CCCC5)ccc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H34O/c1-4-25(2)15-14-24-23-11-9-18-17-20(27-19-7-5-6-8-19)10-12-21(18)22(23)13-16-26(24,25)3/h1,10,12,17,19,22-24H,5-9,11,13-16H2,2-3H3/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | OLLFLZAMVZTDFR-JMTTVTNBSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|