C20H24O4 — CID 101064271
(8S,13S,14S,17R)-17-ethynyl-9-hydroperoxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 101064271) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (8S,13S,14S,17R)-17-ethynyl-9-hydroperoxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,13S,14S,17R)-17-ethynyl-9-hydroperoxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 101064271 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (8S,13S,14S,17R)-17-ethynyl-9-hydroperoxy-13-methyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4C3(OO)CC[C@@]21C |
| InChI | InChI=1S/C20H24O4/c1-3-19(22)9-8-16-17-6-4-13-12-14(21)5-7-15(13)20(17,24-23)11-10-18(16,19)2/h1,5,7,12,16-17,21-23H,4,6,8-11H2,2H3/t16-,17-,18-,19-,20?/m0/s1 |
| InChIKey | GPBRQZVLSZBIPK-LREPDPPJSA-N |
| XLogP | 3.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|