C20H25NO6 — CID 4601923
(17-hydroxy-13-methyl-11-nitrooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate (PubChem CID 4601923) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (17-hydroxy-13-methyl-11-nitrooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate.
| Compound Name | (17-hydroxy-13-methyl-11-nitrooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
|---|---|
| PubChem CID | 4601923 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (17-hydroxy-13-methyl-11-nitrooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C2C(O[N+](=O)[O-])CC2(C)C(O)CCC12 |
| InChI | InChI=1S/C20H25NO6/c1-11(22)26-13-4-6-14-12(9-13)3-5-15-16-7-8-18(23)20(16,2)10-17(19(14)15)27-21(24)25/h4,6,9,15-19,23H,3,5,7-8,10H2,1-2H3 |
| InChIKey | UPINFWLBXPICIJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|