C28H35FN2O4 — CID 134362966
N-[4-[[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]oxy]-2-fluorophenyl]-2-(dimethylamino)acetamide (PubChem CID 134362966) has the molecular formula C28H35FN2O4 and a molecular weight of 482.60 g/mol. Its IUPAC name is N-[4-[[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]oxy]-2-fluorophenyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[4-[[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]oxy]-2-fluorophenyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 134362966 |
| Molecular Formula | C28H35FN2O4 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[4-[[(8S,9S,11S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]oxy]-2-fluorophenyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(O[C@H]2C[C@]3(C)[C@@H](O)CC[C@H]3[C@@H]3CCc4cc(O)ccc4[C@H]32)cc1F |
| InChI | InChI=1S/C28H35FN2O4/c1-28-14-24(35-18-6-10-23(22(29)13-18)30-26(34)15-31(2)3)27-19-8-5-17(32)12-16(19)4-7-20(27)21(28)9-11-25(28)33/h5-6,8,10,12-13,20-21,24-25,27,32-33H,4,7,9,11,14-15H2,1-3H3,(H,30,34)/t20-,21-,24-,25-,27+,28-/m0/s1 |
| InChIKey | HRWIKGZXCWZJLE-OBVSDHRRSA-N |
| XLogP | 4.31 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |