C26H42O4Si2 — CID 635399
[13-methyl-3,11-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 635399) has the molecular formula C26H42O4Si2 and a molecular weight of 474.79 g/mol. Its IUPAC name is [13-methyl-3,11-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [13-methyl-3,11-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 635399 |
| Molecular Formula | C26H42O4Si2 |
| Molecular Weight | 474.79 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [13-methyl-3,11-bis(trimethylsilyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1CCC2C3CCc4cc(O[Si](C)(C)C)ccc4C3C(O[Si](C)(C)C)CC12C |
| InChI | InChI=1S/C26H42O4Si2/c1-17(27)28-24-14-13-22-21-11-9-18-15-19(29-31(3,4)5)10-12-20(18)25(21)23(16-26(22,24)2)30-32(6,7)8/h10,12,15,21-25H,9,11,13-14,16H2,1-8H3 |
| InChIKey | AEGBKQCTQGIXLI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.79 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|