C34H60O3Si2 — CID 10816933
4-[(8S,9S,11S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]butan-1-ol (PubChem CID 10816933) has the molecular formula C34H60O3Si2 and a molecular weight of 573.02 g/mol. Its IUPAC name is 4-[(8S,9S,11S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]butan-1-ol.
| Compound Name | 4-[(8S,9S,11S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]butan-1-ol |
|---|---|
| PubChem CID | 10816933 |
| Molecular Formula | C34H60O3Si2 |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | 4-[(8S,9S,11S,13S,14S,17S)-3,17-bis[[tert-butyl(dimethyl)silyl]oxy]-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2[C@@H](CCCCO)C[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C34H60O3Si2/c1-32(2,3)38(8,9)36-26-16-18-27-24(22-26)15-17-28-29-19-20-30(37-39(10,11)33(4,5)6)34(29,7)23-25(31(27)28)14-12-13-21-35/h16,18,22,25,28-31,35H,12-15,17,19-21,23H2,1-11H3/t25-,28-,29-,30-,31+,34-/m0/s1 |
| InChIKey | FKPNXGGKULCBHV-ZRCUXOMGSA-N |
| XLogP | 9.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|