C34H40O3 — CID 14429692
2-[(8S,9S,11R,13S,14S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol (PubChem CID 14429692) has the molecular formula C34H40O3 and a molecular weight of 496.69 g/mol. Its IUPAC name is 2-[(8S,9S,11R,13S,14S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol.
| Compound Name | 2-[(8S,9S,11R,13S,14S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol |
|---|---|
| PubChem CID | 14429692 |
| Molecular Formula | C34H40O3 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | 2-[(8S,9S,11R,13S,14S,17S)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol |
| SMILES | C[C@]12C[C@H](CCO)[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C34H40O3/c1-34-21-27(18-19-35)33-29-15-13-28(36-22-24-8-4-2-5-9-24)20-26(29)12-14-30(33)31(34)16-17-32(34)37-23-25-10-6-3-7-11-25/h2-11,13,15,20,27,30-33,35H,12,14,16-19,21-23H2,1H3/t27-,30-,31-,32-,33+,34-/m0/s1 |
| InChIKey | NQMWSPPJGSEUHN-KVHLUJKDSA-N |
| XLogP | 7.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |