C34H38O2 — CID 90856822
(8S,9S,13S,14S)-11-ethenyl-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 90856822) has the molecular formula C34H38O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is (8S,9S,13S,14S)-11-ethenyl-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S)-11-ethenyl-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 90856822 |
| Molecular Formula | C34H38O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (8S,9S,13S,14S)-11-ethenyl-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C=CC1C[C@]2(C)C(OCc3ccccc3)CC[C@H]2[C@@H]2CCc3cc(OCc4ccccc4)ccc3[C@@H]12 |
| InChI | InChI=1S/C34H38O2/c1-3-26-21-34(2)31(18-19-32(34)36-23-25-12-8-5-9-13-25)30-16-14-27-20-28(15-17-29(27)33(26)30)35-22-24-10-6-4-7-11-24/h3-13,15,17,20,26,30-33H,1,14,16,18-19,21-23H2,2H3/t26?,30-,31-,32?,33+,34-/m0/s1 |
| InChIKey | KZEPUKMYUDWBKA-XDDNEHCPSA-N |
| XLogP | 8.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|