C37H46O3 — CID 11307221
(8S,9S,11R,13S,14S)-13-methyl-3,17-bis(phenylmethoxy)-11-(2-propan-2-yloxyethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 11307221) has the molecular formula C37H46O3 and a molecular weight of 538.77 g/mol. Its IUPAC name is (8S,9S,11R,13S,14S)-13-methyl-3,17-bis(phenylmethoxy)-11-(2-propan-2-yloxyethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,11R,13S,14S)-13-methyl-3,17-bis(phenylmethoxy)-11-(2-propan-2-yloxyethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 11307221 |
| Molecular Formula | C37H46O3 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | (8S,9S,11R,13S,14S)-13-methyl-3,17-bis(phenylmethoxy)-11-(2-propan-2-yloxyethyl)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)OCC[C@H]1C[C@]2(C)C(OCc3ccccc3)CC[C@H]2[C@@H]2CCc3cc(OCc4ccccc4)ccc3[C@@H]12 |
| InChI | InChI=1S/C37H46O3/c1-26(2)38-21-20-30-23-37(3)34(18-19-35(37)40-25-28-12-8-5-9-13-28)33-16-14-29-22-31(15-17-32(29)36(30)33)39-24-27-10-6-4-7-11-27/h4-13,15,17,22,26,30,33-36H,14,16,18-21,23-25H2,1-3H3/t30-,33-,34-,35?,36+,37-/m0/s1 |
| InChIKey | MMBFDBVZLOUCHN-DDPVZDTGSA-N |
| XLogP | 8.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |