C38H40O2 — CID 11692241
(8S,9R,11R,13S,14S,17S)-13-methyl-11-phenyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 11692241) has the molecular formula C38H40O2 and a molecular weight of 528.74 g/mol. Its IUPAC name is (8S,9R,11R,13S,14S,17S)-13-methyl-11-phenyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9R,11R,13S,14S,17S)-13-methyl-11-phenyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 11692241 |
| Molecular Formula | C38H40O2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | (8S,9R,11R,13S,14S,17S)-13-methyl-11-phenyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | C[C@]12C[C@@H](c3ccccc3)[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C38H40O2/c1-38-24-34(29-15-9-4-10-16-29)37-32-20-18-31(39-25-27-11-5-2-6-12-27)23-30(32)17-19-33(37)35(38)21-22-36(38)40-26-28-13-7-3-8-14-28/h2-16,18,20,23,33-37H,17,19,21-22,24-26H2,1H3/t33-,34-,35-,36-,37+,38-/m0/s1 |
| InChIKey | MZSZXHLUPZGVMF-WRQFUQGOSA-N |
| XLogP | 9.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |