C36H44O3 — CID 11226251
(8S,9S,11S,13S,14S)-11-(3-methoxypropyl)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 11226251) has the molecular formula C36H44O3 and a molecular weight of 524.75 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S)-11-(3-methoxypropyl)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,11S,13S,14S)-11-(3-methoxypropyl)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 11226251 |
| Molecular Formula | C36H44O3 |
| Molecular Weight | 524.75 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | (8S,9S,11S,13S,14S)-11-(3-methoxypropyl)-13-methyl-3,17-bis(phenylmethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COCCC[C@H]1C[C@]2(C)C(OCc3ccccc3)CC[C@H]2[C@@H]2CCc3cc(OCc4ccccc4)ccc3[C@@H]12 |
| InChI | InChI=1S/C36H44O3/c1-36-23-29(14-9-21-37-2)35-31-18-16-30(38-24-26-10-5-3-6-11-26)22-28(31)15-17-32(35)33(36)19-20-34(36)39-25-27-12-7-4-8-13-27/h3-8,10-13,16,18,22,29,32-35H,9,14-15,17,19-21,23-25H2,1-2H3/t29-,32-,33-,34?,35+,36-/m0/s1 |
| InChIKey | XGZLBOXUCLXWRY-WNVOWGBMSA-N |
| XLogP | 8.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.75 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|