C23H34O4 — CID 59410006
2-[(11R)-3-methoxy-17-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol (PubChem CID 59410006) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[(11R)-3-methoxy-17-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol.
| Compound Name | 2-[(11R)-3-methoxy-17-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol |
|---|---|
| PubChem CID | 59410006 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[(11R)-3-methoxy-17-(methoxymethoxy)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]ethanol |
| SMILES | COCOC1CCC2C3CCc4cc(OC)ccc4C3[C@@H](CCO)CC12C |
| InChI | InChI=1S/C23H34O4/c1-23-13-16(10-11-24)22-18-7-5-17(26-3)12-15(18)4-6-19(22)20(23)8-9-21(23)27-14-25-2/h5,7,12,16,19-22,24H,4,6,8-11,13-14H2,1-3H3/t16-,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | IDUAPWHDGXRZSD-ABNMGAQLSA-N |
| XLogP | 4.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|