C20H26O3 — CID 142660210
(8S,9R,13S,14S)-11-(hydroxymethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 142660210) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is (8S,9R,13S,14S)-11-(hydroxymethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9R,13S,14S)-11-(hydroxymethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 142660210 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (8S,9R,13S,14S)-11-(hydroxymethyl)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2C(CO)C[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H26O3/c1-20-10-13(11-21)19-15-6-4-14(23-2)9-12(15)3-5-16(19)17(20)7-8-18(20)22/h4,6,9,13,16-17,19,21H,3,5,7-8,10-11H2,1-2H3/t13?,16-,17-,19+,20-/m0/s1 |
| InChIKey | JUQHFELZHDDMGE-KKWDYKRQSA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |