C24H26O2 — CID 23396844
(8S,9R,11S,13S,14S)-3-hydroxy-13-methyl-11-phenyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 23396844) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S)-3-hydroxy-13-methyl-11-phenyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,9R,11S,13S,14S)-3-hydroxy-13-methyl-11-phenyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 23396844 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (8S,9R,11S,13S,14S)-3-hydroxy-13-methyl-11-phenyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C[C@H](c3ccccc3)[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C24H26O2/c1-24-14-20(15-5-3-2-4-6-15)23-18-10-8-17(25)13-16(18)7-9-19(23)21(24)11-12-22(24)26/h2-6,8,10,13,19-21,23,25H,7,9,11-12,14H2,1H3/t19-,20+,21-,23+,24-/m0/s1 |
| InChIKey | BGEGQELNFDHQKK-SKWRHMBASA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |