C32H42ClNO3 — CID 66931695
(8S,9R,11S,13S,14S)-3-acetyl-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;hydrochloride (PubChem CID 66931695) has the molecular formula C32H42ClNO3 and a molecular weight of 524.15 g/mol. Its IUPAC name is (8S,9R,11S,13S,14S)-3-acetyl-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;hydrochloride.
| Compound Name | (8S,9R,11S,13S,14S)-3-acetyl-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;hydrochloride |
|---|---|
| PubChem CID | 66931695 |
| Molecular Formula | C32H42ClNO3 |
| Molecular Weight | 524.15 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | (8S,9R,11S,13S,14S)-3-acetyl-11-[4-[2-(diethylamino)ethoxy]phenyl]-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one;hydrochloride |
| SMILES | CCN(CC)CCOc1ccc([C@H]2C[C@]3(C)C(=O)CC[C@H]3[C@@H]3CCc4cc(C(C)=O)ccc4[C@H]32)cc1.Cl |
| InChI | InChI=1S/C32H41NO3.ClH/c1-5-33(6-2)17-18-36-25-11-7-22(8-12-25)28-20-32(4)29(15-16-30(32)35)27-14-10-24-19-23(21(3)34)9-13-26(24)31(27)28;/h7-9,11-13,19,27-29,31H,5-6,10,14-18,20H2,1-4H3;1H/t27-,28+,29-,31+,32-;/m0./s1 |
| InChIKey | SDCYFIDJYXOHIT-VCGJUSOSSA-N |
| XLogP | 6.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.15 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |