C24H36N2O2 — CID 10045592
(4aS,4bR,10bS,12aS)-8-[2-(diethylamino)ethoxy]-12a-methyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one (PubChem CID 10045592) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (4aS,4bR,10bS,12aS)-8-[2-(diethylamino)ethoxy]-12a-methyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one.
| Compound Name | (4aS,4bR,10bS,12aS)-8-[2-(diethylamino)ethoxy]-12a-methyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one |
|---|---|
| PubChem CID | 10045592 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (4aS,4bR,10bS,12aS)-8-[2-(diethylamino)ethoxy]-12a-methyl-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-2-one |
| SMILES | CCN(CC)CCOc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)NC(=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H36N2O2/c1-4-26(5-2)14-15-28-18-7-9-19-17(16-18)6-8-21-20(19)12-13-24(3)22(21)10-11-23(27)25-24/h7,9,16,20-22H,4-6,8,10-15H2,1-3H3,(H,25,27)/t20-,21-,22+,24+/m1/s1 |
| InChIKey | DGOUYNALPXWNRD-SVPADUAOSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |