C31H36Cl2N2O3 — CID 10007866
(12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl) (Z)-3-[2-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate (PubChem CID 10007866) has the molecular formula C31H36Cl2N2O3 and a molecular weight of 555.55 g/mol. Its IUPAC name is (12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl) (Z)-3-[2-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate.
| Compound Name | (12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl) (Z)-3-[2-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 10007866 |
| Molecular Formula | C31H36Cl2N2O3 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl) (Z)-3-[2-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate |
| SMILES | CC12CCC3c4ccc(OC(=O)/C=C\c5ccccc5N(CCCl)CCCl)cc4CCC3C1CCC(=O)N2 |
| InChI | InChI=1S/C31H36Cl2N2O3/c1-31-15-14-25-24-10-8-23(20-22(24)6-9-26(25)27(31)11-12-29(36)34-31)38-30(37)13-7-21-4-2-3-5-28(21)35(18-16-32)19-17-33/h2-5,7-8,10,13,20,25-27H,6,9,11-12,14-19H2,1H3,(H,34,36)/b13-7- |
| InChIKey | YMTBEACVOMZUAJ-QPEQYQDCSA-N |
| XLogP | 6.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|