C36H36O4 — CID 163070246
[(8S,9S,13S,14S,17S)-13-methyl-3-(3-phenylprop-2-enoyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-phenylprop-2-enoate (PubChem CID 163070246) has the molecular formula C36H36O4 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(8S,9S,13S,14S,17S)-13-methyl-3-(3-phenylprop-2-enoyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-phenylprop-2-enoate.
| Compound Name | [(8S,9S,13S,14S,17S)-13-methyl-3-(3-phenylprop-2-enoyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163070246 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(8S,9S,13S,14S,17S)-13-methyl-3-(3-phenylprop-2-enoyloxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 3-phenylprop-2-enoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)C=Cc5ccccc5)cc4CC[C@@H]3[C@@H]1CC[C@@H]2OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C36H36O4/c1-36-23-22-30-29-17-15-28(39-34(37)20-12-25-8-4-2-5-9-25)24-27(29)14-16-31(30)32(36)18-19-33(36)40-35(38)21-13-26-10-6-3-7-11-26/h2-13,15,17,20-21,24,30-33H,14,16,18-19,22-23H2,1H3/t30-,31+,32+,33+,36+/m1/s1 |
| InChIKey | PIUXIDSEUWPIRR-BWIKUZBLSA-N |
| XLogP | 7.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|