C24H32O4S — CID 101366921
[(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-sulfanylbutanoate (PubChem CID 101366921) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-sulfanylbutanoate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-sulfanylbutanoate |
|---|---|
| PubChem CID | 101366921 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 4-sulfanylbutanoate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCc4cc(OC(=O)CCCS)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H32O4S/c1-15(25)27-22-10-9-21-20-7-5-16-14-17(28-23(26)4-3-13-29)6-8-18(16)19(20)11-12-24(21,22)2/h6,8,14,19-22,29H,3-5,7,9-13H2,1-2H3/t19-,20-,21+,22+,24+/m1/s1 |
| InChIKey | INAIYWZIOQODOX-NTYLBUJVSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|