C28H38O4 — CID 122640238
[(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate (PubChem CID 122640238) has the molecular formula C28H38O4 and a molecular weight of 438.61 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 122640238 |
| Molecular Formula | C28H38O4 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-acetyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 3-cyclopentylpropanoate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3CCc4cc(OC(=O)CCC5CCCC5)ccc4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H38O4/c1-18(29)31-26-13-12-25-24-10-8-20-17-21(32-27(30)14-7-19-5-3-4-6-19)9-11-22(20)23(24)15-16-28(25,26)2/h9,11,17,19,23-26H,3-8,10,12-16H2,1-2H3/t23-,24-,25+,26+,28+/m1/s1 |
| InChIKey | MPHYWYVDOKJIJJ-VMBLQBCYSA-N |
| XLogP | 6.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|