C32H40Cl2N2O3 — CID 10415645
[(4aS,4bR,10bS,12aS)-12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 10415645) has the molecular formula C32H40Cl2N2O3 and a molecular weight of 571.59 g/mol. Its IUPAC name is [(4aS,4bR,10bS,12aS)-12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | [(4aS,4bR,10bS,12aS)-12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 10415645 |
| Molecular Formula | C32H40Cl2N2O3 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [(4aS,4bR,10bS,12aS)-12a-methyl-2-oxo-1,3,4,4a,4b,5,6,10b,11,12-decahydronaphtho[2,1-f]quinolin-8-yl] 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)CCCc5ccc(N(CCCl)CCCl)cc5)cc4CC[C@H]3[C@@H]1CCC(=O)N2 |
| InChI | InChI=1S/C32H40Cl2N2O3/c1-32-16-15-27-26-12-10-25(21-23(26)7-11-28(27)29(32)13-14-30(37)35-32)39-31(38)4-2-3-22-5-8-24(9-6-22)36(19-17-33)20-18-34/h5-6,8-10,12,21,27-29H,2-4,7,11,13-20H2,1H3,(H,35,37)/t27-,28-,29+,32+/m1/s1 |
| InChIKey | SCDFSXROLJJMRL-LEWVKQBFSA-N |
| XLogP | 6.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|