C41H49NO8 — CID 24837845
[(8R,9S,13S,14S,17S)-17-[2-[4-[4-[bis(2-hydroxyethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 24837845) has the molecular formula C41H49NO8 and a molecular weight of 683.84 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-[2-[4-[4-[bis(2-hydroxyethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-[2-[4-[4-[bis(2-hydroxyethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 24837845 |
| Molecular Formula | C41H49NO8 |
| Molecular Weight | 683.84 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-[2-[4-[4-[bis(2-hydroxyethyl)amino]phenyl]butanoyloxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)c5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2OC(=O)COC(=O)CCCc1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C41H49NO8/c1-41-21-20-34-33-17-15-32(49-40(47)29-7-3-2-4-8-29)26-30(33)12-16-35(34)36(41)18-19-37(41)50-39(46)27-48-38(45)9-5-6-28-10-13-31(14-11-28)42(22-24-43)23-25-44/h2-4,7-8,10-11,13-15,17,26,34-37,43-44H,5-6,9,12,16,18-25,27H2,1H3/t34-,35-,36+,37+,41+/m1/s1 |
| InChIKey | HHYYYOUBTCZHQW-UUBSBJJBSA-N |
| XLogP | 6.03 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.84 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|