C41H50O6S — CID 58587603
4-O-[(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-O-[2-(2-sulfanyl-2-adamantyl)ethyl] butanedioate (PubChem CID 58587603) has the molecular formula C41H50O6S and a molecular weight of 670.91 g/mol. Its IUPAC name is 4-O-[(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-O-[2-(2-sulfanyl-2-adamantyl)ethyl] butanedioate.
| Compound Name | 4-O-[(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-O-[2-(2-sulfanyl-2-adamantyl)ethyl] butanedioate |
|---|---|
| PubChem CID | 58587603 |
| Molecular Formula | C41H50O6S |
| Molecular Weight | 670.91 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 4-O-[(8R,9S,13S,14S,17S)-3-benzoyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] 1-O-[2-(2-sulfanyl-2-adamantyl)ethyl] butanedioate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)c5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2OC(=O)CCC(=O)OCCC1(S)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C41H50O6S/c1-40-16-15-33-32-10-8-31(46-39(44)27-5-3-2-4-6-27)24-28(32)7-9-34(33)35(40)11-12-36(40)47-38(43)14-13-37(42)45-18-17-41(48)29-20-25-19-26(22-29)23-30(41)21-25/h2-6,8,10,24-26,29-30,33-36,48H,7,9,11-23H2,1H3/t25?,26?,29?,30?,33-,34-,35+,36+,40+,41?/m1/s1 |
| InChIKey | RHTIFZOFVHPDIL-QXQYURLDSA-N |
| XLogP | 8.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.91 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|