C36H42N6O5 — CID 22815305
[(13S)-17-[2-[2-[[4,6-bis(aziridin-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 22815305) has the molecular formula C36H42N6O5 and a molecular weight of 638.77 g/mol. Its IUPAC name is [(13S)-17-[2-[2-[[4,6-bis(aziridin-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(13S)-17-[2-[2-[[4,6-bis(aziridin-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 22815305 |
| Molecular Formula | C36H42N6O5 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | [(13S)-17-[2-[2-[[4,6-bis(aziridin-1-yl)-1,3,5-triazin-2-yl]amino]ethoxy]acetyl]oxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@]12CCC3c4ccc(OC(=O)c5ccccc5)cc4CCC3C1CCC2OC(=O)COCCNc1nc(N2CC2)nc(N2CC2)n1 |
| InChI | InChI=1S/C36H42N6O5/c1-36-14-13-27-26-10-8-25(46-32(44)23-5-3-2-4-6-23)21-24(26)7-9-28(27)29(36)11-12-30(36)47-31(43)22-45-20-15-37-33-38-34(41-16-17-41)40-35(39-33)42-18-19-42/h2-6,8,10,21,27-30H,7,9,11-20,22H2,1H3,(H,37,38,39,40)/t27?,28?,29?,30?,36-/m0/s1 |
| InChIKey | SOCWCKKHJNPZKT-CTFTYTAHSA-N |
| XLogP | 4.63 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|