C20H26O3 — CID 162852171
8-hydroxy-11-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one (PubChem CID 162852171) has the molecular formula C20H26O3 and a molecular weight of 314.42 g/mol. Its IUPAC name is 8-hydroxy-11-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one.
| Compound Name | 8-hydroxy-11-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one |
|---|---|
| PubChem CID | 162852171 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 8-hydroxy-11-methoxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one |
| SMILES | COC1CC2(C)C(=O)CCCC2C2CCc3cc(O)ccc3C12 |
| InChI | InChI=1S/C20H26O3/c1-20-11-17(23-2)19-14-9-7-13(21)10-12(14)6-8-15(19)16(20)4-3-5-18(20)22/h7,9-10,15-17,19,21H,3-6,8,11H2,1-2H3 |
| InChIKey | WSVPJEYZOQRTQN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |