C24H33FO3Si — CID 10387217
(8S,9S,11S,13S,14S,16S,17S)-16-fluoro-11-methoxy-13-methyl-17-(2-trimethylsilylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10387217) has the molecular formula C24H33FO3Si and a molecular weight of 416.61 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,16S,17S)-16-fluoro-11-methoxy-13-methyl-17-(2-trimethylsilylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,16S,17S)-16-fluoro-11-methoxy-13-methyl-17-(2-trimethylsilylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10387217 |
| Molecular Formula | C24H33FO3Si |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (8S,9S,11S,13S,14S,16S,17S)-16-fluoro-11-methoxy-13-methyl-17-(2-trimethylsilylethynyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CO[C@H]1C[C@@]2(C)[C@@H](C[C@H](F)[C@@]2(O)C#C[Si](C)(C)C)[C@@H]2CCc3cc(O)ccc3[C@H]21 |
| InChI | InChI=1S/C24H33FO3Si/c1-23-14-20(28-2)22-17-9-7-16(26)12-15(17)6-8-18(22)19(23)13-21(25)24(23,27)10-11-29(3,4)5/h7,9,12,18-22,26-27H,6,8,13-14H2,1-5H3/t18-,19-,20-,21-,22+,23-,24-/m0/s1 |
| InChIKey | XUOJPOYBNMBLDV-DAMCVVMBSA-N |
| XLogP | 4.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|