C33H54O3Sn — CID 70401423
(8S,9S,11S,13S,14S,17R)-11-methoxy-13-methyl-17-[(Z)-2-tributylstannylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70401423) has the molecular formula C33H54O3Sn and a molecular weight of 617.50 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17R)-11-methoxy-13-methyl-17-[(Z)-2-tributylstannylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17R)-11-methoxy-13-methyl-17-[(Z)-2-tributylstannylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70401423 |
| Molecular Formula | C33H54O3Sn |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | (8S,9S,11S,13S,14S,17R)-11-methoxy-13-methyl-17-[(Z)-2-tributylstannylethenyl]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCCC[Sn](/C=C\[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3[C@@H](OC)C[C@@]21C)(CCCC)CCCC |
| InChI | InChI=1S/C21H27O3.3C4H9.Sn/c1-4-21(23)10-9-17-16-7-5-13-11-14(22)6-8-15(13)19(16)18(24-3)12-20(17,21)2;3*1-3-4-2;/h1,4,6,8,11,16-19,22-23H,5,7,9-10,12H2,2-3H3;3*1,3-4H2,2H3;/t16-,17-,18-,19+,20-,21-;;;;/m0..../s1 |
| InChIKey | NMHKYQRPZMVLHC-ILPXOQTDSA-N |
| XLogP | 8.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |