C34H56O3Si — CID 69105016
6-[(9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]-2-methylhexan-2-ol (PubChem CID 69105016) has the molecular formula C34H56O3Si and a molecular weight of 540.91 g/mol. Its IUPAC name is 6-[(9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]-2-methylhexan-2-ol.
| Compound Name | 6-[(9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 69105016 |
| Molecular Formula | C34H56O3Si |
| Molecular Weight | 540.91 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | 6-[(9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]-2-methylhexan-2-ol |
| SMILES | C=CC12CCc3cc(OC)ccc3[C@H]1[C@@H](CCCCC(C)(C)O)C[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C34H56O3Si/c1-11-34-21-19-24-22-26(36-8)15-16-27(24)30(34)25(14-12-13-20-32(5,6)35)23-33(7)28(34)17-18-29(33)37-38(9,10)31(2,3)4/h11,15-16,22,25,28-30,35H,1,12-14,17-21,23H2,2-10H3/t25-,28+,29-,30+,33-,34?/m0/s1 |
| InChIKey | HKHXAQIFTXCFNM-RYGVFMNKSA-N |
| XLogP | 9.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.91 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|