C28H38F5NO5S — CID 11422006
[(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[(6R)-7,7,8,8,8-pentafluoro-6-hydroxyoctyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 11422006) has the molecular formula C28H38F5NO5S and a molecular weight of 595.67 g/mol. Its IUPAC name is [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[(6R)-7,7,8,8,8-pentafluoro-6-hydroxyoctyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[(6R)-7,7,8,8,8-pentafluoro-6-hydroxyoctyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 11422006 |
| Molecular Formula | C28H38F5NO5S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[(6R)-7,7,8,8,8-pentafluoro-6-hydroxyoctyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C=CC12CCc3cc(NS(=O)(=O)O)ccc3C1[C@@H](CCCCC[C@@H](O)C(F)(F)C(F)(F)F)C[C@@]1(C)C2CC[C@@H]1O |
| InChI | InChI=1S/C28H38F5NO5S/c1-3-26-14-13-17-15-19(34-40(37,38)39)9-10-20(17)24(26)18(16-25(2)21(26)11-12-22(25)35)7-5-4-6-8-23(36)27(29,30)28(31,32)33/h3,9-10,15,18,21-24,34-36H,1,4-8,11-14,16H2,2H3,(H,37,38,39)/t18-,21?,22-,23+,24?,25-,26?/m0/s1 |
| InChIKey | GSYDSTUABSTFEJ-KOPLJQKRSA-N |
| XLogP | 6.41 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|