C28H42O3 — CID 11384800
(9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-7-hydroxyoctyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11384800) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-7-hydroxyoctyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-7-hydroxyoctyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11384800 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-7-hydroxyoctyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCCC[C@H](C)O)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C28H42O3/c1-4-28-16-15-20-17-22(30)11-12-23(20)26(28)21(10-8-6-5-7-9-19(2)29)18-27(3)24(28)13-14-25(27)31/h4,11-12,17,19,21,24-26,29-31H,1,5-10,13-16,18H2,2-3H3/t19-,21-,24+,25-,26+,27-,28?/m0/s1 |
| InChIKey | XMFMHBJULGKBEI-UEZMQCSTSA-N |
| XLogP | 6.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|