C27H37NO2S — CID 11453460
6-[(9S,11S,13S,14S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexyl thiocyanate (PubChem CID 11453460) has the molecular formula C27H37NO2S and a molecular weight of 439.67 g/mol. Its IUPAC name is 6-[(9S,11S,13S,14S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexyl thiocyanate.
| Compound Name | 6-[(9S,11S,13S,14S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexyl thiocyanate |
|---|---|
| PubChem CID | 11453460 |
| Molecular Formula | C27H37NO2S |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 6-[(9S,11S,13S,14S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexyl thiocyanate |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCCCSC#N)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C27H37NO2S/c1-3-27-14-13-19-16-21(29)9-10-22(19)25(27)20(8-6-4-5-7-15-31-18-28)17-26(2)23(27)11-12-24(26)30/h3,9-10,16,20,23-25,29-30H,1,4-8,11-15,17H2,2H3/t20-,23+,24-,25+,26-,27?/m0/s1 |
| InChIKey | JGOVCRIEUAAYAD-ZLLZZARCSA-N |
| XLogP | 6.56 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|