C26H38O2 — CID 90689262
(9S,13S,14S)-8-ethenyl-3-methoxy-13-methyl-11-pentyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 90689262) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (9S,13S,14S)-8-ethenyl-3-methoxy-13-methyl-11-pentyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (9S,13S,14S)-8-ethenyl-3-methoxy-13-methyl-11-pentyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 90689262 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (9S,13S,14S)-8-ethenyl-3-methoxy-13-methyl-11-pentyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=CC12CCc3cc(OC)ccc3[C@H]1C(CCCCC)C[C@]1(C)C(O)CC[C@@H]21 |
| InChI | InChI=1S/C26H38O2/c1-5-7-8-9-19-17-25(3)22(12-13-23(25)27)26(6-2)15-14-18-16-20(28-4)10-11-21(18)24(19)26/h6,10-11,16,19,22-24,27H,2,5,7-9,12-15,17H2,1,3-4H3/t19?,22-,23?,24-,25+,26?/m1/s1 |
| InChIKey | UHBFABPASJHRFK-LCVFVSJYSA-N |
| XLogP | 6.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|