C34H54O3Si — CID 87695877
7-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]heptanal (PubChem CID 87695877) has the molecular formula C34H54O3Si and a molecular weight of 538.89 g/mol. Its IUPAC name is 7-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]heptanal.
| Compound Name | 7-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]heptanal |
|---|---|
| PubChem CID | 87695877 |
| Molecular Formula | C34H54O3Si |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | 7-[(8R,9S,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-8-ethenyl-3-methoxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]heptanal |
| SMILES | C=C[C@@]12CCc3cc(OC)ccc3[C@H]1[C@@H](CCCCCCC=O)C[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C34H54O3Si/c1-9-34-21-20-25-23-27(36-6)16-17-28(25)31(34)26(15-13-11-10-12-14-22-35)24-33(5)29(34)18-19-30(33)37-38(7,8)32(2,3)4/h9,16-17,22-23,26,29-31H,1,10-15,18-21,24H2,2-8H3/t26-,29+,30-,31+,33-,34-/m0/s1 |
| InChIKey | BRQTVBAMBOPFCO-CMLLYFSOSA-N |
| XLogP | 9.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|