C27H40O3 — CID 11315905
(9S,11S,13S,14S,17S)-8-ethenyl-11-[(6R)-6-hydroxyheptyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11315905) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is (9S,11S,13S,14S,17S)-8-ethenyl-11-[(6R)-6-hydroxyheptyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(6R)-6-hydroxyheptyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11315905 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(6R)-6-hydroxyheptyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCC[C@@H](C)O)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C27H40O3/c1-4-27-15-14-19-16-21(29)10-11-22(19)25(27)20(9-7-5-6-8-18(2)28)17-26(3)23(27)12-13-24(26)30/h4,10-11,16,18,20,23-25,28-30H,1,5-9,12-15,17H2,2-3H3/t18-,20+,23-,24+,25-,26+,27?/m1/s1 |
| InChIKey | LKSZODBUNOGDFE-GYERSHMASA-N |
| XLogP | 5.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|