C29H40F5NO5S — CID 87695915
[(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,9,9,9-pentafluoro-7-hydroxynonyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 87695915) has the molecular formula C29H40F5NO5S and a molecular weight of 609.70 g/mol. Its IUPAC name is [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,9,9,9-pentafluoro-7-hydroxynonyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,9,9,9-pentafluoro-7-hydroxynonyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 87695915 |
| Molecular Formula | C29H40F5NO5S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,9,9,9-pentafluoro-7-hydroxynonyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C=CC12CCc3cc(NS(=O)(=O)O)ccc3C1[C@@H](CCCCCCC(O)C(F)(F)C(F)(F)F)C[C@@]1(C)C2CC[C@@H]1O |
| InChI | InChI=1S/C29H40F5NO5S/c1-3-27-15-14-18-16-20(35-41(38,39)40)10-11-21(18)25(27)19(17-26(2)22(27)12-13-23(26)36)8-6-4-5-7-9-24(37)28(30,31)29(32,33)34/h3,10-11,16,19,22-25,35-37H,1,4-9,12-15,17H2,2H3,(H,38,39,40)/t19-,22?,23-,24?,25?,26-,27?/m0/s1 |
| InChIKey | VZVAUYCAVZZHRL-RFHKXOSNSA-N |
| XLogP | 6.80 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|