C28H40F3NO5S — CID 69104891
[(11S,13S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(7,7,7-trifluoro-6-hydroxyheptyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 69104891) has the molecular formula C28H40F3NO5S and a molecular weight of 559.69 g/mol. Its IUPAC name is [(11S,13S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(7,7,7-trifluoro-6-hydroxyheptyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(7,7,7-trifluoro-6-hydroxyheptyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 69104891 |
| Molecular Formula | C28H40F3NO5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | [(11S,13S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(7,7,7-trifluoro-6-hydroxyheptyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C=CC12CCc3cc(NS(=O)(=O)O)ccc3C1[C@@H](CCCCCC(O)C(F)(F)F)C[C@@]1(C)C2CC[C@]1(C)O |
| InChI | InChI=1S/C28H40F3NO5S/c1-4-27-15-12-18-16-20(32-38(35,36)37)10-11-21(18)24(27)19(8-6-5-7-9-23(33)28(29,30)31)17-25(2)22(27)13-14-26(25,3)34/h4,10-11,16,19,22-24,32-34H,1,5-9,12-15,17H2,2-3H3,(H,35,36,37)/t19-,22?,23?,24?,25-,26-,27?/m0/s1 |
| InChIKey | VRRIUFZGEKGKHW-MMYZBYGVSA-N |
| XLogP | 6.16 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|