C27H37F3O3 — CID 162599636
(8R,17S)-8-ethenyl-13,17-dimethyl-11-(6,6,6-trifluoro-5-hydroxyhexyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 162599636) has the molecular formula C27H37F3O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is (8R,17S)-8-ethenyl-13,17-dimethyl-11-(6,6,6-trifluoro-5-hydroxyhexyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,17S)-8-ethenyl-13,17-dimethyl-11-(6,6,6-trifluoro-5-hydroxyhexyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 162599636 |
| Molecular Formula | C27H37F3O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (8R,17S)-8-ethenyl-13,17-dimethyl-11-(6,6,6-trifluoro-5-hydroxyhexyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=C[C@@]12CCc3cc(O)ccc3C1C(CCCCC(O)C(F)(F)F)CC1(C)C2CC[C@]1(C)O |
| InChI | InChI=1S/C27H37F3O3/c1-4-26-14-11-17-15-19(31)9-10-20(17)23(26)18(7-5-6-8-22(32)27(28,29)30)16-24(2)21(26)12-13-25(24,3)33/h4,9-10,15,18,21-23,31-33H,1,5-8,11-14,16H2,2-3H3/t18?,21?,22?,23?,24?,25-,26-/m0/s1 |
| InChIKey | UFNCJDFDAUMMGA-VCBVQECMSA-N |
| XLogP | 6.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|