C26H35NO2 — CID 11509423
6-[(8R,11S,13S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanenitrile (PubChem CID 11509423) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is 6-[(8R,11S,13S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanenitrile.
| Compound Name | 6-[(8R,11S,13S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanenitrile |
|---|---|
| PubChem CID | 11509423 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 6-[(8R,11S,13S,17S)-8-ethenyl-3,17-dihydroxy-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-11-yl]hexanenitrile |
| SMILES | C=C[C@@]12CCc3cc(O)ccc3C1[C@@H](CCCCCC#N)C[C@@]1(C)C2CC[C@@H]1O |
| InChI | InChI=1S/C26H35NO2/c1-3-26-14-13-18-16-20(28)9-10-21(18)24(26)19(8-6-4-5-7-15-27)17-25(2)22(26)11-12-23(25)29/h3,9-10,16,19,22-24,28-29H,1,4-8,11-14,17H2,2H3/t19-,22?,23-,24?,25-,26-/m0/s1 |
| InChIKey | OWYSPVSFLROLKX-LHLMVXSNSA-N |
| XLogP | 5.87 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|