C28H40F3NO5S — CID 69104592
[(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 69104592) has the molecular formula C28H40F3NO5S and a molecular weight of 559.69 g/mol. Its IUPAC name is [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 69104592 |
| Molecular Formula | C28H40F3NO5S |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C=C[C@@]12CCc3cc(NS(=O)(=O)O)ccc3[C@H]1[C@@H](CCCCCCC(O)C(F)(F)F)C[C@@]1(C)[C@H]2CC[C@@H]1O |
| InChI | InChI=1S/C28H40F3NO5S/c1-3-27-15-14-18-16-20(32-38(35,36)37)10-11-21(18)25(27)19(17-26(2)22(27)12-13-23(26)33)8-6-4-5-7-9-24(34)28(29,30)31/h3,10-11,16,19,22-25,32-34H,1,4-9,12-15,17H2,2H3,(H,35,36,37)/t19-,22+,23-,24?,25+,26-,27-/m0/s1 |
| InChIKey | QRAONMJVAYSFDM-GETKXBJESA-N |
| XLogP | 6.16 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|