C27H38F3NO5S — CID 91105075
[(13S,17S)-17-hydroxy-13-methyl-8-(9,9,9-trifluoro-8-hydroxynon-1-enyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 91105075) has the molecular formula C27H38F3NO5S and a molecular weight of 545.66 g/mol. Its IUPAC name is [(13S,17S)-17-hydroxy-13-methyl-8-(9,9,9-trifluoro-8-hydroxynon-1-enyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(13S,17S)-17-hydroxy-13-methyl-8-(9,9,9-trifluoro-8-hydroxynon-1-enyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 91105075 |
| Molecular Formula | C27H38F3NO5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [(13S,17S)-17-hydroxy-13-methyl-8-(9,9,9-trifluoro-8-hydroxynon-1-enyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C[C@]12CCC3c4ccc(NS(=O)(=O)O)cc4CCC3(C=CCCCCCC(O)C(F)(F)F)C1CC[C@@H]2O |
| InChI | InChI=1S/C27H38F3NO5S/c1-25-15-13-21-20-9-8-19(31-37(34,35)36)17-18(20)12-16-26(21,22(25)10-11-23(25)32)14-6-4-2-3-5-7-24(33)27(28,29)30/h6,8-9,14,17,21-24,31-33H,2-5,7,10-13,15-16H2,1H3,(H,34,35,36)/t21?,22?,23-,24?,25-,26?/m0/s1 |
| InChIKey | SQOHRKGEKFYJNI-PJNWQIFCSA-N |
| XLogP | 5.92 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|