C29H40F3NO5S — CID 91318163
[(13S,17S)-17-hydroxy-13-methyl-8-[(9S)-10,11,11-trifluoro-9-hydroxyundeca-1,10-dienyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 91318163) has the molecular formula C29H40F3NO5S and a molecular weight of 571.70 g/mol. Its IUPAC name is [(13S,17S)-17-hydroxy-13-methyl-8-[(9S)-10,11,11-trifluoro-9-hydroxyundeca-1,10-dienyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(13S,17S)-17-hydroxy-13-methyl-8-[(9S)-10,11,11-trifluoro-9-hydroxyundeca-1,10-dienyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 91318163 |
| Molecular Formula | C29H40F3NO5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [(13S,17S)-17-hydroxy-13-methyl-8-[(9S)-10,11,11-trifluoro-9-hydroxyundeca-1,10-dienyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C[C@]12CCC3c4ccc(NS(=O)(=O)O)cc4CCC3(C=CCCCCCC[C@H](O)C(F)=C(F)F)C1CC[C@@H]2O |
| InChI | InChI=1S/C29H40F3NO5S/c1-28-16-14-22-21-10-9-20(33-39(36,37)38)18-19(21)13-17-29(22,24(28)11-12-25(28)35)15-7-5-3-2-4-6-8-23(34)26(30)27(31)32/h7,9-10,15,18,22-25,33-35H,2-6,8,11-14,16-17H2,1H3,(H,36,37,38)/t22?,23-,24?,25-,28-,29?/m0/s1 |
| InChIKey | UKJIKMNPPMTFMW-CLRZGCSVSA-N |
| XLogP | 6.82 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|