C29H42F3NO5S — CID 69105260
[(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid (PubChem CID 69105260) has the molecular formula C29H42F3NO5S and a molecular weight of 573.72 g/mol. Its IUPAC name is [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid.
| Compound Name | [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
|---|---|
| PubChem CID | 69105260 |
| Molecular Formula | C29H42F3NO5S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | [(8R,9S,11S,13S,14S,17S)-8-ethenyl-17-hydroxy-13,17-dimethyl-11-(8,8,8-trifluoro-7-hydroxyoctyl)-6,7,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-yl]sulfamic acid |
| SMILES | C=C[C@@]12CCc3cc(NS(=O)(=O)O)ccc3[C@H]1[C@@H](CCCCCCC(O)C(F)(F)F)C[C@@]1(C)[C@H]2CC[C@]1(C)O |
| InChI | InChI=1S/C29H42F3NO5S/c1-4-28-16-13-19-17-21(33-39(36,37)38)11-12-22(19)25(28)20(18-26(2)23(28)14-15-27(26,3)35)9-7-5-6-8-10-24(34)29(30,31)32/h4,11-12,17,20,23-25,33-35H,1,5-10,13-16,18H2,2-3H3,(H,36,37,38)/t20-,23+,24?,25+,26-,27-,28-/m0/s1 |
| InChIKey | AFAZXGKHBIWXNH-KSKWQZMSSA-N |
| XLogP | 6.55 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|