C30H39F7O3 — CID 11433181
(9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-8,8,9,9,10,10,10-heptafluoro-7-hydroxydecyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11433181) has the molecular formula C30H39F7O3 and a molecular weight of 580.63 g/mol. Its IUPAC name is (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-8,8,9,9,10,10,10-heptafluoro-7-hydroxydecyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-8,8,9,9,10,10,10-heptafluoro-7-hydroxydecyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11433181 |
| Molecular Formula | C30H39F7O3 |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | (9S,11S,13S,14S,17S)-8-ethenyl-11-[(7S)-8,8,9,9,10,10,10-heptafluoro-7-hydroxydecyl]-13-methyl-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCCC[C@H](O)C(F)(F)C(F)(F)C(F)(F)F)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C30H39F7O3/c1-3-27-15-14-18-16-20(38)10-11-21(18)25(27)19(17-26(2)22(27)12-13-23(26)39)8-6-4-5-7-9-24(40)28(31,32)29(33,34)30(35,36)37/h3,10-11,16,19,22-25,38-40H,1,4-9,12-15,17H2,2H3/t19-,22+,23-,24-,25+,26-,27?/m0/s1 |
| InChIKey | UNQIURZJZOSXJO-DDGWEKRBSA-N |
| XLogP | 7.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|