C31H47NO2 — CID 11385771
(9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-(6-piperidin-1-ylhexyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 11385771) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-(6-piperidin-1-ylhexyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-(6-piperidin-1-ylhexyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 11385771 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (9S,11S,13S,14S,17S)-8-ethenyl-13-methyl-11-(6-piperidin-1-ylhexyl)-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=CC12CCc3cc(O)ccc3[C@H]1[C@@H](CCCCCCN1CCCCC1)C[C@]1(C)[C@@H](O)CC[C@@H]21 |
| InChI | InChI=1S/C31H47NO2/c1-3-31-17-16-23-21-25(33)12-13-26(23)29(31)24(22-30(2)27(31)14-15-28(30)34)11-7-4-5-8-18-32-19-9-6-10-20-32/h3,12-13,21,24,27-29,33-34H,1,4-11,14-20,22H2,2H3/t24-,27+,28-,29+,30-,31?/m0/s1 |
| InChIKey | JJCBCYHTUSZCDD-FITZNEQHSA-N |
| XLogP | 6.83 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|