C33H44N2O5S — CID 10188471
[(8R,11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 10188471) has the molecular formula C33H44N2O5S and a molecular weight of 580.79 g/mol. Its IUPAC name is [(8R,11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8R,11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 10188471 |
| Molecular Formula | C33H44N2O5S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | [(8R,11S,13S,17S)-8-ethenyl-17-hydroxy-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-7,9,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | C=C[C@@]12CCc3cc(OS(N)(=O)=O)ccc3C1[C@@H](c1ccc(OCCN3CCCCC3)cc1)C[C@@]1(C)C2CC[C@@H]1O |
| InChI | InChI=1S/C33H44N2O5S/c1-3-33-16-15-24-21-26(40-41(34,37)38)11-12-27(24)31(33)28(22-32(2)29(33)13-14-30(32)36)23-7-9-25(10-8-23)39-20-19-35-17-5-4-6-18-35/h3,7-12,21,28-31,36H,1,4-6,13-20,22H2,2H3,(H2,34,37,38)/t28-,29?,30+,31?,32+,33+/m1/s1 |
| InChIKey | NNRMSWZKPZYPCL-FKNYIXTGSA-N |
| XLogP | 5.30 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|