C33H42FNO3 — CID 68852407
[(8S,9R,11S,13S,14S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 68852407) has the molecular formula C33H42FNO3 and a molecular weight of 519.70 g/mol. Its IUPAC name is [(8S,9R,11S,13S,14S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8S,9R,11S,13S,14S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 68852407 |
| Molecular Formula | C33H42FNO3 |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | [(8S,9R,11S,13S,14S,17R)-17-fluoro-13-methyl-11-[4-(2-piperidin-1-ylethoxy)phenyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2[C@@H](c2ccc(OCCN3CCCCC3)cc2)C[C@]2(C)[C@H](F)CC[C@@H]12 |
| InChI | InChI=1S/C33H42FNO3/c1-22(36)38-26-11-13-27-24(20-26)8-12-28-30-14-15-31(34)33(30,2)21-29(32(27)28)23-6-9-25(10-7-23)37-19-18-35-16-4-3-5-17-35/h6-7,9-11,13,20,28-32H,3-5,8,12,14-19,21H2,1-2H3/t28-,29+,30-,31+,32+,33-/m0/s1 |
| InChIKey | GRSGTGSLFDFTTC-BSCDBSEYSA-N |
| XLogP | 7.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|