C37H48N2O2 — CID 177277192
(8S,11S,13S,14S,17R)-11-(4-cyclopropylphenyl)-13-methyl-3-[2-(4-methylpiperazin-1-yl)ethoxy]-17-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 177277192) has the molecular formula C37H48N2O2 and a molecular weight of 552.80 g/mol. Its IUPAC name is (8S,11S,13S,14S,17R)-11-(4-cyclopropylphenyl)-13-methyl-3-[2-(4-methylpiperazin-1-yl)ethoxy]-17-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,11S,13S,14S,17R)-11-(4-cyclopropylphenyl)-13-methyl-3-[2-(4-methylpiperazin-1-yl)ethoxy]-17-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 177277192 |
| Molecular Formula | C37H48N2O2 |
| Molecular Weight | 552.80 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | (8S,11S,13S,14S,17R)-11-(4-cyclopropylphenyl)-13-methyl-3-[2-(4-methylpiperazin-1-yl)ethoxy]-17-prop-2-ynyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C#CC[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OCCN5CCN(C)CC5)ccc4C3[C@@H](c3ccc(C4CC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C37H48N2O2/c1-4-16-37(40)17-15-34-32-13-11-29-24-30(41-23-22-39-20-18-38(3)19-21-39)12-14-31(29)35(32)33(25-36(34,37)2)28-9-7-27(8-10-28)26-5-6-26/h1,7-10,12,14,24,26,32-35,40H,5-6,11,13,15-23,25H2,2-3H3/t32-,33+,34-,35?,36-,37-/m0/s1 |
| InChIKey | PNPIGNOHRIKHHZ-DHZYGANXSA-N |
| XLogP | 6.19 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.80 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|