C35H42O4 — CID 177277207
(8S,11S,13S,14S,17S)-3-(2-cyclopropyloxyethoxy)-11-(4-cyclopropylphenyl)-17-(1-hydroxyprop-2-ynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 177277207) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is (8S,11S,13S,14S,17S)-3-(2-cyclopropyloxyethoxy)-11-(4-cyclopropylphenyl)-17-(1-hydroxyprop-2-ynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8S,11S,13S,14S,17S)-3-(2-cyclopropyloxyethoxy)-11-(4-cyclopropylphenyl)-17-(1-hydroxyprop-2-ynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 177277207 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (8S,11S,13S,14S,17S)-3-(2-cyclopropyloxyethoxy)-11-(4-cyclopropylphenyl)-17-(1-hydroxyprop-2-ynyl)-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C#CC(O)[C@]1(O)CC[C@H]2[C@@H]3CCc4cc(OCCOC5CC5)ccc4C3[C@@H](c3ccc(C4CC4)cc3)C[C@@]21C |
| InChI | InChI=1S/C35H42O4/c1-3-32(36)35(37)17-16-31-29-14-10-25-20-27(39-19-18-38-26-11-12-26)13-15-28(25)33(29)30(21-34(31,35)2)24-8-6-23(7-9-24)22-4-5-22/h1,6-9,13,15,20,22,26,29-33,36-37H,4-5,10-12,14,16-19,21H2,2H3/t29-,30+,31-,32?,33?,34-,35+/m0/s1 |
| InChIKey | LSKDVPSOQIFTKT-UNQHGZOISA-N |
| XLogP | 6.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|