C22H28O2 — CID 23766330
(17S)-17-ethynyl-3-methoxy-11,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 23766330) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (17S)-17-ethynyl-3-methoxy-11,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (17S)-17-ethynyl-3-methoxy-11,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 23766330 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (17S)-17-ethynyl-3-methoxy-11,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C#C[C@@]1(O)CCC2C3CCc4cc(OC)ccc4C3C(C)CC21C |
| InChI | InChI=1S/C22H28O2/c1-5-22(23)11-10-19-18-8-6-15-12-16(24-4)7-9-17(15)20(18)14(2)13-21(19,22)3/h1,7,9,12,14,18-20,23H,6,8,10-11,13H2,2-4H3/t14?,18?,19?,20?,21?,22-/m1/s1 |
| InChIKey | MLZOUZLJIKTUIT-AAXSSUIJSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|