C21H26O4 — CID 162999631
17-ethynyl-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,11,17-triol (PubChem CID 162999631) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 17-ethynyl-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,11,17-triol.
| Compound Name | 17-ethynyl-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,11,17-triol |
|---|---|
| PubChem CID | 162999631 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 17-ethynyl-2-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,11,17-triol |
| SMILES | C#CC1(O)CCC2C3CCc4cc(O)c(OC)cc4C3C(O)CC21C |
| InChI | InChI=1S/C21H26O4/c1-4-21(24)8-7-15-13-6-5-12-9-16(22)18(25-3)10-14(12)19(13)17(23)11-20(15,21)2/h1,9-10,13,15,17,19,22-24H,5-8,11H2,2-3H3 |
| InChIKey | MLYHVYUBDAULPY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|